C17H23ClN2O — CID 6449602
(2Z)-2-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-pyrrolidin-1-ylethanone;hydrochloride (PubChem CID 6449602) has the molecular formula C17H23ClN2O and a molecular weight of 306.84 g/mol. Its IUPAC name is (2Z)-2-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-pyrrolidin-1-ylethanone;hydrochloride.
| Compound Name | (2Z)-2-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-pyrrolidin-1-ylethanone;hydrochloride |
|---|---|
| PubChem CID | 6449602 |
| Molecular Formula | C17H23ClN2O |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (2Z)-2-(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-pyrrolidin-1-ylethanone;hydrochloride |
| SMILES | CC1(C)Cc2ccccc2/C(=C/C(=O)N2CCCC2)N1.Cl |
| InChI | InChI=1S/C17H22N2O.ClH/c1-17(2)12-13-7-3-4-8-14(13)15(18-17)11-16(20)19-9-5-6-10-19;/h3-4,7-8,11,18H,5-6,9-10,12H2,1-2H3;1H/b15-11-; |
| InChIKey | HHORCUWPMJOPLA-PNCOJPCNSA-N |
| XLogP | 3.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|