About 3-benzyl-7-(2,3-dihydroindol-1-yl)triazolo[4,5-d]pyrimidine
3-benzyl-7-(2,3-dihydroindol-1-yl)triazolo[4,5-d]pyrimidine (PubChem CID 644973) has the molecular formula C19H16N6
and a molecular weight of 328.38 g/mol. Its IUPAC name is 3-benzyl-7-(2,3-dihydroindol-1-yl)triazolo[4,5-d]pyrimidine.
Molecular Properties
| Compound Name | 3-benzyl-7-(2,3-dihydroindol-1-yl)triazolo[4,5-d]pyrimidine |
| PubChem CID | 644973 |
| Molecular Formula | C19H16N6 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 3-benzyl-7-(2,3-dihydroindol-1-yl)triazolo[4,5-d]pyrimidine |
| SMILES | c1ccc(Cn2nnc3c(N4CCc5ccccc54)ncnc32)cc1 |
| InChI | InChI=1S/C19H16N6/c1-2-6-14(7-3-1)12-25-19-17(22-23-25)18(20-13-21-19)24-11-10-15-8-4-5-9-16(15)24/h1-9,13H,10-12H2 |
| InChIKey | WKMZYYGTJZCIOS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-benzyl-7-(2,3-dihydroindol-1-yl)triazolo[4,5-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-7-(2,3-dihydroindol-1-yl)triazolo[4,5-d]pyrimidine?
The IUPAC name of 3-benzyl-7-(2,3-dihydroindol-1-yl)triazolo[4,5-d]pyrimidine (CID 644973) is 3-benzyl-7-(2,3-dihydroindol-1-yl)triazolo[4,5-d]pyrimidine.
What is the SMILES notation for 3-benzyl-7-(2,3-dihydroindol-1-yl)triazolo[4,5-d]pyrimidine?
The canonical SMILES for 3-benzyl-7-(2,3-dihydroindol-1-yl)triazolo[4,5-d]pyrimidine is c1ccc(Cn2nnc3c(N4CCc5ccccc54)ncnc32)cc1.
What is the InChIKey of 3-benzyl-7-(2,3-dihydroindol-1-yl)triazolo[4,5-d]pyrimidine?
The InChIKey is WKMZYYGTJZCIOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N6/c1-2-6-14(7-3-1)12-25-19-17(22-23-25)18(20-13-21-19)24-11-10-15-8-4-5-9-16(15)24/h1-9,13H,10-12H2.
What are the key properties of 3-benzyl-7-(2,3-dihydroindol-1-yl)triazolo[4,5-d]pyrimidine?
3-benzyl-7-(2,3-dihydroindol-1-yl)triazolo[4,5-d]pyrimidine has a molecular weight of 328.38 g/mol, XLogP of 2.96, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-7-(2,3-dihydroindol-1-yl)triazolo[4,5-d]pyrimidine is sourced from PubChem (CID 644973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).