C20H36 — CID 6449801
hex-1-ene;(4E)-4-methylhexa-1,4-diene;5-methylhexa-1,4-diene (PubChem CID 6449801) has the molecular formula C20H36 and a molecular weight of 276.51 g/mol. Its IUPAC name is hex-1-ene;(4E)-4-methylhexa-1,4-diene;5-methylhexa-1,4-diene.
| Compound Name | hex-1-ene;(4E)-4-methylhexa-1,4-diene;5-methylhexa-1,4-diene |
|---|---|
| PubChem CID | 6449801 |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | hex-1-ene;(4E)-4-methylhexa-1,4-diene;5-methylhexa-1,4-diene |
| SMILES | C=CC/C(C)=C/C.C=CCC=C(C)C.C=CCCCC |
| InChI | InChI=1S/2C7H12.C6H12/c1-4-5-6-7(2)3;1-4-6-7(3)5-2;1-3-5-6-4-2/h4,6H,1,5H2,2-3H3;4-5H,1,6H2,2-3H3;3H,1,4-6H2,2H3/b;7-5+; |
| InChIKey | CNVLZIITFNQVDE-QVSSGMAGSA-N |
| XLogP | 7.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|