About hydron;1-[4-(2-methylpropoxy)phenyl]-3-piperidin-1-ylpropan-1-one;chloride
hydron;1-[4-(2-methylpropoxy)phenyl]-3-piperidin-1-ylpropan-1-one;chloride (PubChem CID 644984) has the molecular formula C18H28ClNO2
and a molecular weight of 325.88 g/mol. Its IUPAC name is hydron;1-[4-(2-methylpropoxy)phenyl]-3-piperidin-1-ylpropan-1-one;chloride.
Molecular Properties
| Compound Name | hydron;1-[4-(2-methylpropoxy)phenyl]-3-piperidin-1-ylpropan-1-one;chloride |
| PubChem CID | 644984 |
| Molecular Formula | C18H28ClNO2 |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | hydron;1-[4-(2-methylpropoxy)phenyl]-3-piperidin-1-ylpropan-1-one;chloride |
| SMILES | CC(C)COc1ccc(C(=O)CCN2CCCCC2)cc1.[Cl-].[H+] |
| InChI | InChI=1S/C18H27NO2.ClH/c1-15(2)14-21-17-8-6-16(7-9-17)18(20)10-13-19-11-4-3-5-12-19;/h6-9,15H,3-5,10-14H2,1-2H3;1H |
| InChIKey | VMAUDRNSDVRVPM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze hydron;1-[4-(2-methylpropoxy)phenyl]-3-piperidin-1-ylpropan-1-one;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;1-[4-(2-methylpropoxy)phenyl]-3-piperidin-1-ylpropan-1-one;chloride?
The IUPAC name of hydron;1-[4-(2-methylpropoxy)phenyl]-3-piperidin-1-ylpropan-1-one;chloride (CID 644984) is hydron;1-[4-(2-methylpropoxy)phenyl]-3-piperidin-1-ylpropan-1-one;chloride.
What is the SMILES notation for hydron;1-[4-(2-methylpropoxy)phenyl]-3-piperidin-1-ylpropan-1-one;chloride?
The canonical SMILES for hydron;1-[4-(2-methylpropoxy)phenyl]-3-piperidin-1-ylpropan-1-one;chloride is CC(C)COc1ccc(C(=O)CCN2CCCCC2)cc1.[Cl-].[H+].
What is the InChIKey of hydron;1-[4-(2-methylpropoxy)phenyl]-3-piperidin-1-ylpropan-1-one;chloride?
The InChIKey is VMAUDRNSDVRVPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO2.ClH/c1-15(2)14-21-17-8-6-16(7-9-17)18(20)10-13-19-11-4-3-5-12-19;/h6-9,15H,3-5,10-14H2,1-2H3;1H.
What are the key properties of hydron;1-[4-(2-methylpropoxy)phenyl]-3-piperidin-1-ylpropan-1-one;chloride?
hydron;1-[4-(2-methylpropoxy)phenyl]-3-piperidin-1-ylpropan-1-one;chloride has a molecular weight of 325.88 g/mol, XLogP of 0.90, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;1-[4-(2-methylpropoxy)phenyl]-3-piperidin-1-ylpropan-1-one;chloride is sourced from PubChem (CID 644984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).