C25H27N5O10 — CID 6449873
6,9-bis(2-aminoethylamino)benzo[g]isoquinoline-5,10-dione;bis((E)-but-2-enedioic acid) (PubChem CID 6449873) has the molecular formula C25H27N5O10 and a molecular weight of 557.52 g/mol. Its IUPAC name is 6,9-bis(2-aminoethylamino)benzo[g]isoquinoline-5,10-dione;bis((E)-but-2-enedioic acid).
| Compound Name | 6,9-bis(2-aminoethylamino)benzo[g]isoquinoline-5,10-dione;bis((E)-but-2-enedioic acid) |
|---|---|
| PubChem CID | 6449873 |
| Molecular Formula | C25H27N5O10 |
| Molecular Weight | 557.52 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | 6,9-bis(2-aminoethylamino)benzo[g]isoquinoline-5,10-dione;bis((E)-but-2-enedioic acid) |
| SMILES | NCCNc1ccc(NCCN)c2c1C(=O)c1ccncc1C2=O.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H19N5O2.2C4H4O4/c18-4-7-21-12-1-2-13(22-8-5-19)15-14(12)16(23)10-3-6-20-9-11(10)17(15)24;2*5-3(6)1-2-4(7)8/h1-3,6,9,21-22H,4-5,7-8,18-19H2;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | SVAGFBGXEWPNJC-LVEZLNDCSA-N |
| XLogP | 0.02 |
| TPSA | 272.33 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.52 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|