C19H20N4O2 — CID 644989
3-[[4-(oxolan-2-ylmethylamino)quinazolin-2-yl]amino]phenol (PubChem CID 644989) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 3-[[4-(oxolan-2-ylmethylamino)quinazolin-2-yl]amino]phenol.
| Compound Name | 3-[[4-(oxolan-2-ylmethylamino)quinazolin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 644989 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 3-[[4-(oxolan-2-ylmethylamino)quinazolin-2-yl]amino]phenol |
| SMILES | Oc1cccc(Nc2nc(NCC3CCCO3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C19H20N4O2/c24-14-6-3-5-13(11-14)21-19-22-17-9-2-1-8-16(17)18(23-19)20-12-15-7-4-10-25-15/h1-3,5-6,8-9,11,15,24H,4,7,10,12H2,(H2,20,21,22,23) |
| InChIKey | PEQMTEMWXRAERG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |