C10H18N2 — CID 64500336
3-methyl-1-(propylamino)cyclopentane-1-carbonitrile (PubChem CID 64500336) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 3-methyl-1-(propylamino)cyclopentane-1-carbonitrile.
| Compound Name | 3-methyl-1-(propylamino)cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 64500336 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 3-methyl-1-(propylamino)cyclopentane-1-carbonitrile |
| SMILES | CCCNC1(C#N)CCC(C)C1 |
| InChI | InChI=1S/C10H18N2/c1-3-6-12-10(8-11)5-4-9(2)7-10/h9,12H,3-7H2,1-2H3 |
| InChIKey | XLHYDPPWIADLDK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |