About 3-methoxy-2,4-dimethyl-N-(3-methylcyclopentyl)aniline
3-methoxy-2,4-dimethyl-N-(3-methylcyclopentyl)aniline (PubChem CID 64501091) has the molecular formula C15H23NO
and a molecular weight of 233.35 g/mol. Its IUPAC name is 3-methoxy-2,4-dimethyl-N-(3-methylcyclopentyl)aniline.
Molecular Properties
| Compound Name | 3-methoxy-2,4-dimethyl-N-(3-methylcyclopentyl)aniline |
| PubChem CID | 64501091 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 3-methoxy-2,4-dimethyl-N-(3-methylcyclopentyl)aniline |
| SMILES | COc1c(C)ccc(NC2CCC(C)C2)c1C |
| InChI | InChI=1S/C15H23NO/c1-10-5-7-13(9-10)16-14-8-6-11(2)15(17-4)12(14)3/h6,8,10,13,16H,5,7,9H2,1-4H3 |
| InChIKey | MDLZABPSIDQJRE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methoxy-2,4-dimethyl-N-(3-methylcyclopentyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2,4-dimethyl-N-(3-methylcyclopentyl)aniline?
The IUPAC name of 3-methoxy-2,4-dimethyl-N-(3-methylcyclopentyl)aniline (CID 64501091) is 3-methoxy-2,4-dimethyl-N-(3-methylcyclopentyl)aniline.
What is the SMILES notation for 3-methoxy-2,4-dimethyl-N-(3-methylcyclopentyl)aniline?
The canonical SMILES for 3-methoxy-2,4-dimethyl-N-(3-methylcyclopentyl)aniline is COc1c(C)ccc(NC2CCC(C)C2)c1C.
What is the InChIKey of 3-methoxy-2,4-dimethyl-N-(3-methylcyclopentyl)aniline?
The InChIKey is MDLZABPSIDQJRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO/c1-10-5-7-13(9-10)16-14-8-6-11(2)15(17-4)12(14)3/h6,8,10,13,16H,5,7,9H2,1-4H3.
What are the key properties of 3-methoxy-2,4-dimethyl-N-(3-methylcyclopentyl)aniline?
3-methoxy-2,4-dimethyl-N-(3-methylcyclopentyl)aniline has a molecular weight of 233.35 g/mol, XLogP of 3.91, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2,4-dimethyl-N-(3-methylcyclopentyl)aniline is sourced from PubChem (CID 64501091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).