C10H2F12O4Pd — CID 6450336
bis((Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate);palladium(2+) (PubChem CID 6450336) has the molecular formula C10H2F12O4Pd and a molecular weight of 520.52 g/mol. Its IUPAC name is bis((Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate);palladium(2+).
| Compound Name | bis((Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate);palladium(2+) |
|---|---|
| PubChem CID | 6450336 |
| Molecular Formula | C10H2F12O4Pd |
| Molecular Weight | 520.52 g/mol |
| Exact Mass | 519.88 |
| IUPAC Name | bis((Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate);palladium(2+) |
| SMILES | O=C(/C=C(\[O-])C(F)(F)F)C(F)(F)F.O=C(/C=C(\[O-])C(F)(F)F)C(F)(F)F.[Pd+2] |
| InChI | InChI=1S/2C5H2F6O2.Pd/c2*6-4(7,8)2(12)1-3(13)5(9,10)11;/h2*1,12H;/q;;+2/p-2/b2*2-1-; |
| InChIKey | OVIDFVVPPRGPGR-PAMPIZDHSA-L |
| XLogP | 1.85 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.52 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|