About N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]pyridine-3-carboxamide
N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]pyridine-3-carboxamide (PubChem CID 645036) has the molecular formula C21H17N3O2
and a molecular weight of 343.39 g/mol. Its IUPAC name is N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]pyridine-3-carboxamide |
| PubChem CID | 645036 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]pyridine-3-carboxamide |
| SMILES | CCc1ccc2oc(-c3cccc(NC(=O)c4cccnc4)c3)nc2c1 |
| InChI | InChI=1S/C21H17N3O2/c1-2-14-8-9-19-18(11-14)24-21(26-19)15-5-3-7-17(12-15)23-20(25)16-6-4-10-22-13-16/h3-13H,2H2,1H3,(H,23,25) |
| InChIKey | WLLYEFVBFLDLKE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]pyridine-3-carboxamide?
The IUPAC name of N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]pyridine-3-carboxamide (CID 645036) is N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]pyridine-3-carboxamide.
What is the SMILES notation for N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]pyridine-3-carboxamide?
The canonical SMILES for N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]pyridine-3-carboxamide is CCc1ccc2oc(-c3cccc(NC(=O)c4cccnc4)c3)nc2c1.
What is the InChIKey of N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]pyridine-3-carboxamide?
The InChIKey is WLLYEFVBFLDLKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N3O2/c1-2-14-8-9-19-18(11-14)24-21(26-19)15-5-3-7-17(12-15)23-20(25)16-6-4-10-22-13-16/h3-13H,2H2,1H3,(H,23,25).
What are the key properties of N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]pyridine-3-carboxamide?
N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]pyridine-3-carboxamide has a molecular weight of 343.39 g/mol, XLogP of 4.70, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]pyridine-3-carboxamide is sourced from PubChem (CID 645036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).