C15H30O3 — CID 6450414
(E,3R)-1,1,3-triethoxynon-4-ene (PubChem CID 6450414) has the molecular formula C15H30O3 and a molecular weight of 258.40 g/mol. Its IUPAC name is (E,3R)-1,1,3-triethoxynon-4-ene.
| Compound Name | (E,3R)-1,1,3-triethoxynon-4-ene |
|---|---|
| PubChem CID | 6450414 |
| Molecular Formula | C15H30O3 |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | (E,3R)-1,1,3-triethoxynon-4-ene |
| SMILES | CCCC/C=C/[C@@H](CC(OCC)OCC)OCC |
| InChI | InChI=1S/C15H30O3/c1-5-9-10-11-12-14(16-6-2)13-15(17-7-3)18-8-4/h11-12,14-15H,5-10,13H2,1-4H3/b12-11+/t14-/m0/s1 |
| InChIKey | GMJRSWGCHBIIBV-GETOMWPZSA-N |
| XLogP | 3.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|