(E)-4-oxo-4-[2-(undec-10-enoylamino)ethoxy]but-2-enoic acid

C17H27NO5 — CID 6450467

IUPAC(E)-4-oxo-4-[2-(undec-10-enoylamino)ethoxy]but-2-enoic acid
SMILESC=CCCCCCCCCC(=O)NCCOC(=O)/C=C/C(=O)O
InChIInChI=1S/C17H27NO5/c1-2-3-4-5-6-7-8-9-10-15(19)18-13-14-23-17(22)12-11-16(20)21/h2,11-12H,1,3-10,13-14H2,(H,18,19)(H,20,21)/b12-11+
InChIKeyPYWYRUGHEMNKNW-VAWYXSNFSA-N
MW325.41 g/mol
LogP2.59
Rot. Bonds14

About (E)-4-oxo-4-[2-(undec-10-enoylamino)ethoxy]but-2-enoic acid

(E)-4-oxo-4-[2-(undec-10-enoylamino)ethoxy]but-2-enoic acid (PubChem CID 6450467) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is (E)-4-oxo-4-[2-(undec-10-enoylamino)ethoxy]but-2-enoic acid.

Molecular Properties

Compound Name(E)-4-oxo-4-[2-(undec-10-enoylamino)ethoxy]but-2-enoic acid
PubChem CID6450467
Molecular FormulaC17H27NO5
Molecular Weight325.41 g/mol
Exact Mass325.19
IUPAC Name(E)-4-oxo-4-[2-(undec-10-enoylamino)ethoxy]but-2-enoic acid
SMILESC=CCCCCCCCCC(=O)NCCOC(=O)/C=C/C(=O)O
InChIInChI=1S/C17H27NO5/c1-2-3-4-5-6-7-8-9-10-15(19)18-13-14-23-17(22)12-11-16(20)21/h2,11-12H,1,3-10,13-14H2,(H,18,19)(H,20,21)/b12-11+
InChIKeyPYWYRUGHEMNKNW-VAWYXSNFSA-N
XLogP2.59
TPSA92.70 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds14
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500325.41
LogP ≤ 52.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-4-oxo-4-[2-(undec-10-enoylamino)ethoxy]but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-4-oxo-4-[2-(undec-10-enoylamino)ethoxy]but-2-enoic acid?
The IUPAC name of (E)-4-oxo-4-[2-(undec-10-enoylamino)ethoxy]but-2-enoic acid (CID 6450467) is (E)-4-oxo-4-[2-(undec-10-enoylamino)ethoxy]but-2-enoic acid.
What is the SMILES notation for (E)-4-oxo-4-[2-(undec-10-enoylamino)ethoxy]but-2-enoic acid?
The canonical SMILES for (E)-4-oxo-4-[2-(undec-10-enoylamino)ethoxy]but-2-enoic acid is C=CCCCCCCCCC(=O)NCCOC(=O)/C=C/C(=O)O.
What is the InChIKey of (E)-4-oxo-4-[2-(undec-10-enoylamino)ethoxy]but-2-enoic acid?
The InChIKey is PYWYRUGHEMNKNW-VAWYXSNFSA-N. The full InChI is InChI=1S/C17H27NO5/c1-2-3-4-5-6-7-8-9-10-15(19)18-13-14-23-17(22)12-11-16(20)21/h2,11-12H,1,3-10,13-14H2,(H,18,19)(H,20,21)/b12-11+.
What are the key properties of (E)-4-oxo-4-[2-(undec-10-enoylamino)ethoxy]but-2-enoic acid?
(E)-4-oxo-4-[2-(undec-10-enoylamino)ethoxy]but-2-enoic acid has a molecular weight of 325.41 g/mol, XLogP of 2.59, 14 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-oxo-4-[2-(undec-10-enoylamino)ethoxy]but-2-enoic acid is sourced from PubChem (CID 6450467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).