C21H22O2S — CID 6450532
4-[(E)-1-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)prop-1-en-2-yl]benzoic acid (PubChem CID 6450532) has the molecular formula C21H22O2S and a molecular weight of 338.47 g/mol. Its IUPAC name is 4-[(E)-1-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)prop-1-en-2-yl]benzoic acid.
| Compound Name | 4-[(E)-1-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)prop-1-en-2-yl]benzoic acid |
|---|---|
| PubChem CID | 6450532 |
| Molecular Formula | C21H22O2S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 4-[(E)-1-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)prop-1-en-2-yl]benzoic acid |
| SMILES | C/C(=C\c1ccc2c(c1)C(C)(C)CCS2)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H22O2S/c1-14(16-5-7-17(8-6-16)20(22)23)12-15-4-9-19-18(13-15)21(2,3)10-11-24-19/h4-9,12-13H,10-11H2,1-3H3,(H,22,23)/b14-12+ |
| InChIKey | IXFGZAXVTMBUTB-WYMLVPIESA-N |
| XLogP | 5.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|