C12H24F3NO — CID 64505363
2,2-dimethyl-8-(2,2,2-trifluoroethoxy)octan-3-amine (PubChem CID 64505363) has the molecular formula C12H24F3NO and a molecular weight of 255.32 g/mol. Its IUPAC name is 2,2-dimethyl-8-(2,2,2-trifluoroethoxy)octan-3-amine.
| Compound Name | 2,2-dimethyl-8-(2,2,2-trifluoroethoxy)octan-3-amine |
|---|---|
| PubChem CID | 64505363 |
| Molecular Formula | C12H24F3NO |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 2,2-dimethyl-8-(2,2,2-trifluoroethoxy)octan-3-amine |
| SMILES | CC(C)(C)C(N)CCCCCOCC(F)(F)F |
| InChI | InChI=1S/C12H24F3NO/c1-11(2,3)10(16)7-5-4-6-8-17-9-12(13,14)15/h10H,4-9,16H2,1-3H3 |
| InChIKey | GNUXFTRJSVVOMU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|