C11H17N3 — CID 64505769
3-(3-aminocyclopentyl)-5-methylpyridin-2-amine (PubChem CID 64505769) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 3-(3-aminocyclopentyl)-5-methylpyridin-2-amine.
| Compound Name | 3-(3-aminocyclopentyl)-5-methylpyridin-2-amine |
|---|---|
| PubChem CID | 64505769 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 3-(3-aminocyclopentyl)-5-methylpyridin-2-amine |
| SMILES | Cc1cnc(N)c(C2CCC(N)C2)c1 |
| InChI | InChI=1S/C11H17N3/c1-7-4-10(11(13)14-6-7)8-2-3-9(12)5-8/h4,6,8-9H,2-3,5,12H2,1H3,(H2,13,14) |
| InChIKey | BGYWLZONPWVGBK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |