About 1-cyclopropyl-3-(2,3,4-trifluorophenyl)propan-1-amine
1-cyclopropyl-3-(2,3,4-trifluorophenyl)propan-1-amine (PubChem CID 64506062) has the molecular formula C12H14F3N
and a molecular weight of 229.24 g/mol. Its IUPAC name is 1-cyclopropyl-3-(2,3,4-trifluorophenyl)propan-1-amine.
Molecular Properties
| Compound Name | 1-cyclopropyl-3-(2,3,4-trifluorophenyl)propan-1-amine |
| PubChem CID | 64506062 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 1-cyclopropyl-3-(2,3,4-trifluorophenyl)propan-1-amine |
| SMILES | NC(CCc1ccc(F)c(F)c1F)C1CC1 |
| InChI | InChI=1S/C12H14F3N/c13-9-5-3-8(11(14)12(9)15)4-6-10(16)7-1-2-7/h3,5,7,10H,1-2,4,6,16H2 |
| InChIKey | CLSOQVAITFDBLJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopropyl-3-(2,3,4-trifluorophenyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-3-(2,3,4-trifluorophenyl)propan-1-amine?
The IUPAC name of 1-cyclopropyl-3-(2,3,4-trifluorophenyl)propan-1-amine (CID 64506062) is 1-cyclopropyl-3-(2,3,4-trifluorophenyl)propan-1-amine.
What is the SMILES notation for 1-cyclopropyl-3-(2,3,4-trifluorophenyl)propan-1-amine?
The canonical SMILES for 1-cyclopropyl-3-(2,3,4-trifluorophenyl)propan-1-amine is NC(CCc1ccc(F)c(F)c1F)C1CC1.
What is the InChIKey of 1-cyclopropyl-3-(2,3,4-trifluorophenyl)propan-1-amine?
The InChIKey is CLSOQVAITFDBLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F3N/c13-9-5-3-8(11(14)12(9)15)4-6-10(16)7-1-2-7/h3,5,7,10H,1-2,4,6,16H2.
What are the key properties of 1-cyclopropyl-3-(2,3,4-trifluorophenyl)propan-1-amine?
1-cyclopropyl-3-(2,3,4-trifluorophenyl)propan-1-amine has a molecular weight of 229.24 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-3-(2,3,4-trifluorophenyl)propan-1-amine is sourced from PubChem (CID 64506062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).