C16H20BrN — CID 64506762
3-(3-bromo-4,4-dimethylpentyl)quinoline (PubChem CID 64506762) has the molecular formula C16H20BrN and a molecular weight of 306.25 g/mol. Its IUPAC name is 3-(3-bromo-4,4-dimethylpentyl)quinoline.
| Compound Name | 3-(3-bromo-4,4-dimethylpentyl)quinoline |
|---|---|
| PubChem CID | 64506762 |
| Molecular Formula | C16H20BrN |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 3-(3-bromo-4,4-dimethylpentyl)quinoline |
| SMILES | CC(C)(C)C(Br)CCc1cnc2ccccc2c1 |
| InChI | InChI=1S/C16H20BrN/c1-16(2,3)15(17)9-8-12-10-13-6-4-5-7-14(13)18-11-12/h4-7,10-11,15H,8-9H2,1-3H3 |
| InChIKey | MHBMNCLLALQUEV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|