C10H13ClF3N3O2 — CID 645072
2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 645072) has the molecular formula C10H13ClF3N3O2 and a molecular weight of 299.68 g/mol. Its IUPAC name is 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 645072 |
| Molecular Formula | C10H13ClF3N3O2 |
| Molecular Weight | 299.68 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)Cn1nc(C(F)(F)F)c(Cl)c1C |
| InChI | InChI=1S/C10H13ClF3N3O2/c1-6-8(11)9(10(12,13)14)16-17(6)5-7(18)15-3-4-19-2/h3-5H2,1-2H3,(H,15,18) |
| InChIKey | NCWCDIFRFDAXDT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.68 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|