About 5-(4-chlorophenyl)-2,3-diphenylthiophene
5-(4-chlorophenyl)-2,3-diphenylthiophene (PubChem CID 6450825) has the molecular formula C22H15ClS
and a molecular weight of 346.88 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2,3-diphenylthiophene.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-2,3-diphenylthiophene |
| PubChem CID | 6450825 |
| Molecular Formula | C22H15ClS |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 5-(4-chlorophenyl)-2,3-diphenylthiophene |
| SMILES | Clc1ccc(-c2cc(-c3ccccc3)c(-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C22H15ClS/c23-19-13-11-17(12-14-19)21-15-20(16-7-3-1-4-8-16)22(24-21)18-9-5-2-6-10-18/h1-15H |
| InChIKey | JWXZLCFGVKMEEK-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(4-chlorophenyl)-2,3-diphenylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-2,3-diphenylthiophene?
The IUPAC name of 5-(4-chlorophenyl)-2,3-diphenylthiophene (CID 6450825) is 5-(4-chlorophenyl)-2,3-diphenylthiophene.
What is the SMILES notation for 5-(4-chlorophenyl)-2,3-diphenylthiophene?
The canonical SMILES for 5-(4-chlorophenyl)-2,3-diphenylthiophene is Clc1ccc(-c2cc(-c3ccccc3)c(-c3ccccc3)s2)cc1.
What is the InChIKey of 5-(4-chlorophenyl)-2,3-diphenylthiophene?
The InChIKey is JWXZLCFGVKMEEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15ClS/c23-19-13-11-17(12-14-19)21-15-20(16-7-3-1-4-8-16)22(24-21)18-9-5-2-6-10-18/h1-15H.
What are the key properties of 5-(4-chlorophenyl)-2,3-diphenylthiophene?
5-(4-chlorophenyl)-2,3-diphenylthiophene has a molecular weight of 346.88 g/mol, XLogP of 7.40, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-2,3-diphenylthiophene is sourced from PubChem (CID 6450825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).