C34H26CuO4 — CID 6450843
copper bis((1Z,4E)-3-oxo-1,5-diphenylpenta-1,4-dien-1-olate) (PubChem CID 6450843) has the molecular formula C34H26CuO4 and a molecular weight of 562.12 g/mol. Its IUPAC name is copper bis((1Z,4E)-3-oxo-1,5-diphenylpenta-1,4-dien-1-olate).
| Compound Name | copper bis((1Z,4E)-3-oxo-1,5-diphenylpenta-1,4-dien-1-olate) |
|---|---|
| PubChem CID | 6450843 |
| Molecular Formula | C34H26CuO4 |
| Molecular Weight | 562.12 g/mol |
| Exact Mass | 561.11 |
| IUPAC Name | copper bis((1Z,4E)-3-oxo-1,5-diphenylpenta-1,4-dien-1-olate) |
| SMILES | O=C(/C=C(\[O-])c1ccccc1)/C=C/c1ccccc1.O=C(/C=C(\[O-])c1ccccc1)/C=C/c1ccccc1.[Cu+2] |
| InChI | InChI=1S/2C17H14O2.Cu/c2*18-16(12-11-14-7-3-1-4-8-14)13-17(19)15-9-5-2-6-10-15;/h2*1-13,19H;/q;;+2/p-2/b2*12-11+,17-13-; |
| InChIKey | JWTWTYXRVBLYPR-ZCPHFLNESA-L |
| XLogP | 5.34 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.12 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|