About 6-bromo-7-methyl-1-(2,2,2-trifluoroethoxy)octane
6-bromo-7-methyl-1-(2,2,2-trifluoroethoxy)octane (PubChem CID 64508546) has the molecular formula C11H20BrF3O
and a molecular weight of 305.18 g/mol. Its IUPAC name is 6-bromo-7-methyl-1-(2,2,2-trifluoroethoxy)octane.
Molecular Properties
| Compound Name | 6-bromo-7-methyl-1-(2,2,2-trifluoroethoxy)octane |
| PubChem CID | 64508546 |
| Molecular Formula | C11H20BrF3O |
| Molecular Weight | 305.18 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 6-bromo-7-methyl-1-(2,2,2-trifluoroethoxy)octane |
| SMILES | CC(C)C(Br)CCCCCOCC(F)(F)F |
| InChI | InChI=1S/C11H20BrF3O/c1-9(2)10(12)6-4-3-5-7-16-8-11(13,14)15/h9-10H,3-8H2,1-2H3 |
| InChIKey | UIHFQSKBZPLKAZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.18 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-7-methyl-1-(2,2,2-trifluoroethoxy)octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-7-methyl-1-(2,2,2-trifluoroethoxy)octane?
The IUPAC name of 6-bromo-7-methyl-1-(2,2,2-trifluoroethoxy)octane (CID 64508546) is 6-bromo-7-methyl-1-(2,2,2-trifluoroethoxy)octane.
What is the SMILES notation for 6-bromo-7-methyl-1-(2,2,2-trifluoroethoxy)octane?
The canonical SMILES for 6-bromo-7-methyl-1-(2,2,2-trifluoroethoxy)octane is CC(C)C(Br)CCCCCOCC(F)(F)F.
What is the InChIKey of 6-bromo-7-methyl-1-(2,2,2-trifluoroethoxy)octane?
The InChIKey is UIHFQSKBZPLKAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20BrF3O/c1-9(2)10(12)6-4-3-5-7-16-8-11(13,14)15/h9-10H,3-8H2,1-2H3.
What are the key properties of 6-bromo-7-methyl-1-(2,2,2-trifluoroethoxy)octane?
6-bromo-7-methyl-1-(2,2,2-trifluoroethoxy)octane has a molecular weight of 305.18 g/mol, XLogP of 4.55, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-7-methyl-1-(2,2,2-trifluoroethoxy)octane is sourced from PubChem (CID 64508546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).