C12H22ClF3O — CID 64508910
6-chloro-7,7-dimethyl-1-(2,2,2-trifluoroethoxy)octane (PubChem CID 64508910) has the molecular formula C12H22ClF3O and a molecular weight of 274.75 g/mol. Its IUPAC name is 6-chloro-7,7-dimethyl-1-(2,2,2-trifluoroethoxy)octane.
| Compound Name | 6-chloro-7,7-dimethyl-1-(2,2,2-trifluoroethoxy)octane |
|---|---|
| PubChem CID | 64508910 |
| Molecular Formula | C12H22ClF3O |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 6-chloro-7,7-dimethyl-1-(2,2,2-trifluoroethoxy)octane |
| SMILES | CC(C)(C)C(Cl)CCCCCOCC(F)(F)F |
| InChI | InChI=1S/C12H22ClF3O/c1-11(2,3)10(13)7-5-4-6-8-17-9-12(14,15)16/h10H,4-9H2,1-3H3 |
| InChIKey | PFTLBMWDKGQAJR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|