About (E)-N,N'-di(propan-2-yl)but-2-ene-1,4-diamine
(E)-N,N'-di(propan-2-yl)but-2-ene-1,4-diamine (PubChem CID 6450909) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is (E)-N,N'-di(propan-2-yl)but-2-ene-1,4-diamine.
Molecular Properties
| Compound Name | (E)-N,N'-di(propan-2-yl)but-2-ene-1,4-diamine |
| PubChem CID | 6450909 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | (E)-N,N'-di(propan-2-yl)but-2-ene-1,4-diamine |
| SMILES | CC(C)NC/C=C/CNC(C)C |
| InChI | InChI=1S/C10H22N2/c1-9(2)11-7-5-6-8-12-10(3)4/h5-6,9-12H,7-8H2,1-4H3/b6-5+ |
| InChIKey | XUHWXAYJBQMEAF-AATRIKPKSA-N |
| XLogP | 1.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,N'-di(propan-2-yl)but-2-ene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N'-di(propan-2-yl)but-2-ene-1,4-diamine?
The IUPAC name of (E)-N,N'-di(propan-2-yl)but-2-ene-1,4-diamine (CID 6450909) is (E)-N,N'-di(propan-2-yl)but-2-ene-1,4-diamine.
What is the SMILES notation for (E)-N,N'-di(propan-2-yl)but-2-ene-1,4-diamine?
The canonical SMILES for (E)-N,N'-di(propan-2-yl)but-2-ene-1,4-diamine is CC(C)NC/C=C/CNC(C)C.
What is the InChIKey of (E)-N,N'-di(propan-2-yl)but-2-ene-1,4-diamine?
The InChIKey is XUHWXAYJBQMEAF-AATRIKPKSA-N. The full InChI is InChI=1S/C10H22N2/c1-9(2)11-7-5-6-8-12-10(3)4/h5-6,9-12H,7-8H2,1-4H3/b6-5+.
What are the key properties of (E)-N,N'-di(propan-2-yl)but-2-ene-1,4-diamine?
(E)-N,N'-di(propan-2-yl)but-2-ene-1,4-diamine has a molecular weight of 170.30 g/mol, XLogP of 1.54, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N'-di(propan-2-yl)but-2-ene-1,4-diamine is sourced from PubChem (CID 6450909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).