C9H10N6O3 — CID 64510114
N-methyl-4-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)-1H-pyrrole-2-carboxamide (PubChem CID 64510114) has the molecular formula C9H10N6O3 and a molecular weight of 250.22 g/mol. Its IUPAC name is N-methyl-4-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)-1H-pyrrole-2-carboxamide.
| Compound Name | N-methyl-4-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 64510114 |
| Molecular Formula | C9H10N6O3 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | N-methyl-4-nitro-N-(1H-1,2,4-triazol-5-ylmethyl)-1H-pyrrole-2-carboxamide |
| SMILES | CN(Cc1ncn[nH]1)C(=O)c1cc([N+](=O)[O-])c[nH]1 |
| InChI | InChI=1S/C9H10N6O3/c1-14(4-8-11-5-12-13-8)9(16)7-2-6(3-10-7)15(17)18/h2-3,5,10H,4H2,1H3,(H,11,12,13) |
| InChIKey | JATLFHIFBSMJFT-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 120.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|