C9H16N4O — CID 64510292
N,3-dimethyl-N-(1H-1,2,4-triazol-5-ylmethyl)butanamide (PubChem CID 64510292) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is N,3-dimethyl-N-(1H-1,2,4-triazol-5-ylmethyl)butanamide.
| Compound Name | N,3-dimethyl-N-(1H-1,2,4-triazol-5-ylmethyl)butanamide |
|---|---|
| PubChem CID | 64510292 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | N,3-dimethyl-N-(1H-1,2,4-triazol-5-ylmethyl)butanamide |
| SMILES | CC(C)CC(=O)N(C)Cc1ncn[nH]1 |
| InChI | InChI=1S/C9H16N4O/c1-7(2)4-9(14)13(3)5-8-10-6-11-12-8/h6-7H,4-5H2,1-3H3,(H,10,11,12) |
| InChIKey | WGGGFLCPXPBOFR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |