C12H16N4O3 — CID 64510624
6-[methyl(1H-1,2,4-triazol-5-ylmethyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 64510624) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 6-[methyl(1H-1,2,4-triazol-5-ylmethyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[methyl(1H-1,2,4-triazol-5-ylmethyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 64510624 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 6-[methyl(1H-1,2,4-triazol-5-ylmethyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CN(Cc1ncn[nH]1)C(=O)C1CC=CCC1C(=O)O |
| InChI | InChI=1S/C12H16N4O3/c1-16(6-10-13-7-14-15-10)11(17)8-4-2-3-5-9(8)12(18)19/h2-3,7-9H,4-6H2,1H3,(H,18,19)(H,13,14,15) |
| InChIKey | NJCARSWDMQFAHY-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|