C10H16N4O — CID 64511183
N,3-dimethyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]but-2-enamide (PubChem CID 64511183) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is N,3-dimethyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]but-2-enamide.
| Compound Name | N,3-dimethyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]but-2-enamide |
|---|---|
| PubChem CID | 64511183 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | N,3-dimethyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]but-2-enamide |
| SMILES | CC(C)=CC(=O)N(C)Cc1n[nH]c(C)n1 |
| InChI | InChI=1S/C10H16N4O/c1-7(2)5-10(15)14(4)6-9-11-8(3)12-13-9/h5H,6H2,1-4H3,(H,11,12,13) |
| InChIKey | HLPLENXMCUQIIH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|