C6H10N4S — CID 64511696
1-(1H-imidazol-2-ylmethyl)-1-methylthiourea (PubChem CID 64511696) has the molecular formula C6H10N4S and a molecular weight of 170.24 g/mol. Its IUPAC name is 1-(1H-imidazol-2-ylmethyl)-1-methylthiourea.
| Compound Name | 1-(1H-imidazol-2-ylmethyl)-1-methylthiourea |
|---|---|
| PubChem CID | 64511696 |
| Molecular Formula | C6H10N4S |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 1-(1H-imidazol-2-ylmethyl)-1-methylthiourea |
| SMILES | CN(Cc1ncc[nH]1)C(N)=S |
| InChI | InChI=1S/C6H10N4S/c1-10(6(7)11)4-5-8-2-3-9-5/h2-3H,4H2,1H3,(H2,7,11)(H,8,9) |
| InChIKey | JTIMRDBALHPZBP-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|