C12H18N4O — CID 64511985
2-cyclopent-2-en-1-yl-N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]acetamide (PubChem CID 64511985) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]acetamide.
| Compound Name | 2-cyclopent-2-en-1-yl-N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 64511985 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]acetamide |
| SMILES | Cc1nc(CN(C)C(=O)CC2C=CCC2)n[nH]1 |
| InChI | InChI=1S/C12H18N4O/c1-9-13-11(15-14-9)8-16(2)12(17)7-10-5-3-4-6-10/h3,5,10H,4,6-8H2,1-2H3,(H,13,14,15) |
| InChIKey | WSRVUXJNOYINFU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|