About prop-2-enyl N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]carbamate
prop-2-enyl N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]carbamate (PubChem CID 64512401) has the molecular formula C9H14N4O2
and a molecular weight of 210.24 g/mol. Its IUPAC name is prop-2-enyl N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]carbamate.
Molecular Properties
| Compound Name | prop-2-enyl N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]carbamate |
| PubChem CID | 64512401 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | prop-2-enyl N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]carbamate |
| SMILES | C=CCOC(=O)N(C)Cc1n[nH]c(C)n1 |
| InChI | InChI=1S/C9H14N4O2/c1-4-5-15-9(14)13(3)6-8-10-7(2)11-12-8/h4H,1,5-6H2,2-3H3,(H,10,11,12) |
| InChIKey | JPLLXJREPYULLZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]carbamate?
The IUPAC name of prop-2-enyl N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]carbamate (CID 64512401) is prop-2-enyl N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]carbamate.
What is the SMILES notation for prop-2-enyl N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]carbamate?
The canonical SMILES for prop-2-enyl N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]carbamate is C=CCOC(=O)N(C)Cc1n[nH]c(C)n1.
What is the InChIKey of prop-2-enyl N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]carbamate?
The InChIKey is JPLLXJREPYULLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O2/c1-4-5-15-9(14)13(3)6-8-10-7(2)11-12-8/h4H,1,5-6H2,2-3H3,(H,10,11,12).
What are the key properties of prop-2-enyl N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]carbamate?
prop-2-enyl N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]carbamate has a molecular weight of 210.24 g/mol, XLogP of 0.87, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl N-methyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]carbamate is sourced from PubChem (CID 64512401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).