About (1R)-1-[(2R)-2-aminopropyl]cyclohexa-2,4-dien-1-ol;hydrochloride
(1R)-1-[(2R)-2-aminopropyl]cyclohexa-2,4-dien-1-ol;hydrochloride (PubChem CID 6451279) has the molecular formula C9H16ClNO
and a molecular weight of 189.69 g/mol. Its IUPAC name is (1R)-1-[(2R)-2-aminopropyl]cyclohexa-2,4-dien-1-ol;hydrochloride.
Molecular Properties
| Compound Name | (1R)-1-[(2R)-2-aminopropyl]cyclohexa-2,4-dien-1-ol;hydrochloride |
| PubChem CID | 6451279 |
| Molecular Formula | C9H16ClNO |
| Molecular Weight | 189.69 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | (1R)-1-[(2R)-2-aminopropyl]cyclohexa-2,4-dien-1-ol;hydrochloride |
| SMILES | C[C@@H](N)C[C@@]1(O)C=CC=CC1.Cl |
| InChI | InChI=1S/C9H15NO.ClH/c1-8(10)7-9(11)5-3-2-4-6-9;/h2-5,8,11H,6-7,10H2,1H3;1H/t8-,9-;/m1./s1 |
| InChIKey | OQJIOAUUPWWRGE-VTLYIQCISA-N |
| XLogP | 1.39 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.69 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-1-[(2R)-2-aminopropyl]cyclohexa-2,4-dien-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[(2R)-2-aminopropyl]cyclohexa-2,4-dien-1-ol;hydrochloride?
The IUPAC name of (1R)-1-[(2R)-2-aminopropyl]cyclohexa-2,4-dien-1-ol;hydrochloride (CID 6451279) is (1R)-1-[(2R)-2-aminopropyl]cyclohexa-2,4-dien-1-ol;hydrochloride.
What is the SMILES notation for (1R)-1-[(2R)-2-aminopropyl]cyclohexa-2,4-dien-1-ol;hydrochloride?
The canonical SMILES for (1R)-1-[(2R)-2-aminopropyl]cyclohexa-2,4-dien-1-ol;hydrochloride is C[C@@H](N)C[C@@]1(O)C=CC=CC1.Cl.
What is the InChIKey of (1R)-1-[(2R)-2-aminopropyl]cyclohexa-2,4-dien-1-ol;hydrochloride?
The InChIKey is OQJIOAUUPWWRGE-VTLYIQCISA-N. The full InChI is InChI=1S/C9H15NO.ClH/c1-8(10)7-9(11)5-3-2-4-6-9;/h2-5,8,11H,6-7,10H2,1H3;1H/t8-,9-;/m1./s1.
What are the key properties of (1R)-1-[(2R)-2-aminopropyl]cyclohexa-2,4-dien-1-ol;hydrochloride?
(1R)-1-[(2R)-2-aminopropyl]cyclohexa-2,4-dien-1-ol;hydrochloride has a molecular weight of 189.69 g/mol, XLogP of 1.39, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[(2R)-2-aminopropyl]cyclohexa-2,4-dien-1-ol;hydrochloride is sourced from PubChem (CID 6451279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).