benzyl 2-aminoacetate;4-methylbenzenesulfonic acid

C16H19NO5S — CID 6451311

IUPACbenzyl 2-aminoacetate;4-methylbenzenesulfonic acid
SMILESCc1ccc(S(=O)(=O)O)cc1.NCC(=O)OCc1ccccc1
InChIInChI=1S/C9H11NO2.C7H8O3S/c10-6-9(11)12-7-8-4-2-1-3-5-8;1-6-2-4-7(5-3-6)11(8,9)10/h1-5H,6-7,10H2;2-5H,1H3,(H,8,9,10)
InChIKeyWJKJXKRHMUXQSL-UHFFFAOYSA-N
MW337.40 g/mol
LogP1.93
Rot. Bonds4

About benzyl 2-aminoacetate;4-methylbenzenesulfonic acid

benzyl 2-aminoacetate;4-methylbenzenesulfonic acid (PubChem CID 6451311) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is benzyl 2-aminoacetate;4-methylbenzenesulfonic acid.

Molecular Properties

Compound Namebenzyl 2-aminoacetate;4-methylbenzenesulfonic acid
PubChem CID6451311
Molecular FormulaC16H19NO5S
Molecular Weight337.40 g/mol
Exact Mass337.10
IUPAC Namebenzyl 2-aminoacetate;4-methylbenzenesulfonic acid
SMILESCc1ccc(S(=O)(=O)O)cc1.NCC(=O)OCc1ccccc1
InChIInChI=1S/C9H11NO2.C7H8O3S/c10-6-9(11)12-7-8-4-2-1-3-5-8;1-6-2-4-7(5-3-6)11(8,9)10/h1-5H,6-7,10H2;2-5H,1H3,(H,8,9,10)
InChIKeyWJKJXKRHMUXQSL-UHFFFAOYSA-N
XLogP1.93
TPSA106.69 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500337.40
LogP ≤ 51.93
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze benzyl 2-aminoacetate;4-methylbenzenesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2-aminoacetate;4-methylbenzenesulfonic acid?
The IUPAC name of benzyl 2-aminoacetate;4-methylbenzenesulfonic acid (CID 6451311) is benzyl 2-aminoacetate;4-methylbenzenesulfonic acid.
What is the SMILES notation for benzyl 2-aminoacetate;4-methylbenzenesulfonic acid?
The canonical SMILES for benzyl 2-aminoacetate;4-methylbenzenesulfonic acid is Cc1ccc(S(=O)(=O)O)cc1.NCC(=O)OCc1ccccc1.
What is the InChIKey of benzyl 2-aminoacetate;4-methylbenzenesulfonic acid?
The InChIKey is WJKJXKRHMUXQSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.C7H8O3S/c10-6-9(11)12-7-8-4-2-1-3-5-8;1-6-2-4-7(5-3-6)11(8,9)10/h1-5H,6-7,10H2;2-5H,1H3,(H,8,9,10).
What are the key properties of benzyl 2-aminoacetate;4-methylbenzenesulfonic acid?
benzyl 2-aminoacetate;4-methylbenzenesulfonic acid has a molecular weight of 337.40 g/mol, XLogP of 1.93, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-aminoacetate;4-methylbenzenesulfonic acid is sourced from PubChem (CID 6451311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).