About benzene-1,4-diol;sulfur dioxide
benzene-1,4-diol;sulfur dioxide (PubChem CID 6451318) has the molecular formula C6H6O4S
and a molecular weight of 174.18 g/mol. Its IUPAC name is benzene-1,4-diol;sulfur dioxide.
Molecular Properties
| Compound Name | benzene-1,4-diol;sulfur dioxide |
| PubChem CID | 6451318 |
| Molecular Formula | C6H6O4S |
| Molecular Weight | 174.18 g/mol |
| Exact Mass | 174.00 |
| IUPAC Name | benzene-1,4-diol;sulfur dioxide |
| SMILES | O=S=O.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C6H6O2.O2S/c7-5-1-2-6(8)4-3-5;1-3-2/h1-4,7-8H; |
| InChIKey | ZGUVVJOTWDTXFR-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.18 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,4-diol;sulfur dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,4-diol;sulfur dioxide?
The IUPAC name of benzene-1,4-diol;sulfur dioxide (CID 6451318) is benzene-1,4-diol;sulfur dioxide.
What is the SMILES notation for benzene-1,4-diol;sulfur dioxide?
The canonical SMILES for benzene-1,4-diol;sulfur dioxide is O=S=O.Oc1ccc(O)cc1.
What is the InChIKey of benzene-1,4-diol;sulfur dioxide?
The InChIKey is ZGUVVJOTWDTXFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.O2S/c7-5-1-2-6(8)4-3-5;1-3-2/h1-4,7-8H;.
What are the key properties of benzene-1,4-diol;sulfur dioxide?
benzene-1,4-diol;sulfur dioxide has a molecular weight of 174.18 g/mol, XLogP of 0.43, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,4-diol;sulfur dioxide is sourced from PubChem (CID 6451318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).