C14H8O2 — CID 6451338
2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),3,5,7,10,12,15-heptaene (PubChem CID 6451338) has the molecular formula C14H8O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),3,5,7,10,12,15-heptaene.
| Compound Name | 2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),3,5,7,10,12,15-heptaene |
|---|---|
| PubChem CID | 6451338 |
| Molecular Formula | C14H8O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),3,5,7,10,12,15-heptaene |
| SMILES | c1cc2coc3cccc4coc(c1)c2=c43 |
| InChI | InChI=1S/C14H8O2/c1-3-9-7-16-12-6-2-4-10-8-15-11(5-1)13(9)14(10)12/h1-8H |
| InChIKey | UAVRDVCOMONISG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |