C14H14O2 — CID 6451387
(2S,3R)-2-[(E)-non-1-en-3,5,7-triynyl]oxan-3-ol (PubChem CID 6451387) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is (2S,3R)-2-[(E)-non-1-en-3,5,7-triynyl]oxan-3-ol.
| Compound Name | (2S,3R)-2-[(E)-non-1-en-3,5,7-triynyl]oxan-3-ol |
|---|---|
| PubChem CID | 6451387 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | (2S,3R)-2-[(E)-non-1-en-3,5,7-triynyl]oxan-3-ol |
| SMILES | CC#CC#CC#C/C=C/[C@@H]1OCCC[C@H]1O |
| InChI | InChI=1S/C14H14O2/c1-2-3-4-5-6-7-8-11-14-13(15)10-9-12-16-14/h8,11,13-15H,9-10,12H2,1H3/b11-8+/t13-,14+/m1/s1 |
| InChIKey | WFJPISZWZQHNLX-GELOPOQCSA-N |
| XLogP | 1.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|