C28H50N2O6 — CID 6451408
1-Piperidinyloxy, 4,4'-((1,10-dioxo-1,10-decanediyl)bis(oxy))bis(2,2,6,6-tetramethyl- (PubChem CID 6451408) has the molecular formula C28H50N2O6 and a molecular weight of 510.72 g/mol.
| Compound Name | 1-Piperidinyloxy, 4,4'-((1,10-dioxo-1,10-decanediyl)bis(oxy))bis(2,2,6,6-tetramethyl- |
|---|---|
| PubChem CID | 6451408 |
| Molecular Formula | C28H50N2O6 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.37 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)N([O])C(C)(C)C2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C28H50N2O6/c1-25(2)17-21(18-26(3,4)29(25)33)35-23(31)15-13-11-9-10-12-14-16-24(32)36-22-19-27(5,6)30(34)28(7,8)20-22/h21-22H,9-20H2,1-8H3 |
| InChIKey | XVJWWMHPPKXKRU-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 98.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|