C7H15N9O9 — CID 6451475
N,N-dimethylformamide;1,3,5,7-tetranitro-1,3,5,7-tetrazocane (PubChem CID 6451475) has the molecular formula C7H15N9O9 and a molecular weight of 369.25 g/mol. Its IUPAC name is N,N-dimethylformamide;1,3,5,7-tetranitro-1,3,5,7-tetrazocane.
| Compound Name | N,N-dimethylformamide;1,3,5,7-tetranitro-1,3,5,7-tetrazocane |
|---|---|
| PubChem CID | 6451475 |
| Molecular Formula | C7H15N9O9 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | N,N-dimethylformamide;1,3,5,7-tetranitro-1,3,5,7-tetrazocane |
| SMILES | CN(C)C=O.O=[N+]([O-])N1CN([N+](=O)[O-])CN([N+](=O)[O-])CN([N+](=O)[O-])C1 |
| InChI | InChI=1S/C4H8N8O8.C3H7NO/c13-9(14)5-1-6(10(15)16)3-8(12(19)20)4-7(2-5)11(17)18;1-4(2)3-5/h1-4H2;3H,1-2H3 |
| InChIKey | AAIMWVVYPGXYTB-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 205.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|