2-(3-ethyl-1-hydroxycyclopentyl)butanoic acid

C11H20O3 — CID 64515512

IUPAC2-(3-ethyl-1-hydroxycyclopentyl)butanoic acid
SMILESCCC1CCC(O)(C(CC)C(=O)O)C1
InChIInChI=1S/C11H20O3/c1-3-8-5-6-11(14,7-8)9(4-2)10(12)13/h8-9,14H,3-7H2,1-2H3,(H,12,13)
InChIKeyUAGRYSNNQWUHBG-UHFFFAOYSA-N
MW200.28 g/mol
LogP2.04
Rot. Bonds4

About 2-(3-ethyl-1-hydroxycyclopentyl)butanoic acid

2-(3-ethyl-1-hydroxycyclopentyl)butanoic acid (PubChem CID 64515512) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-(3-ethyl-1-hydroxycyclopentyl)butanoic acid.

Molecular Properties

Compound Name2-(3-ethyl-1-hydroxycyclopentyl)butanoic acid
PubChem CID64515512
Molecular FormulaC11H20O3
Molecular Weight200.28 g/mol
Exact Mass200.14
IUPAC Name2-(3-ethyl-1-hydroxycyclopentyl)butanoic acid
SMILESCCC1CCC(O)(C(CC)C(=O)O)C1
InChIInChI=1S/C11H20O3/c1-3-8-5-6-11(14,7-8)9(4-2)10(12)13/h8-9,14H,3-7H2,1-2H3,(H,12,13)
InChIKeyUAGRYSNNQWUHBG-UHFFFAOYSA-N
XLogP2.04
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.28
LogP ≤ 52.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(3-ethyl-1-hydroxycyclopentyl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(1-hydroxy-3-methylcyclopentyl)butanoic acid
CID 64515511
2-(3-ethyl-1-hydroxycyclopentyl)-2-fluoroacetic acid
CID 79367180
2-(1-hydroxy-3-methoxycyclobutyl)butanoic acid
CID 106824095
2-[1-(1-aminopropyl)-3-ethylcyclopentyl]acetic acid
CID 66096901
2-(1-hydroxy-4-propan-2-ylcycloheptyl)pentanoic acid
CID 83042358
2-[1-(dimethylcarbamoyl)-4-hydroxypiperidin-4-yl]butanoic acid
CID 83266074
3-ethyl-1-(3-methylbutyl)cyclopentan-1-ol
CID 65154263
2-(4-hydroxy-1-propan-2-ylazepan-4-yl)butanoic acid
CID 65076966
3-ethyl-1-hydroxycyclobutane-1-carboxylic acid
CID 90717755
4-ethyl-1-propan-2-ylcycloheptan-1-ol
CID 65085832
2-(1-hydroxycyclohexyl)butanoic acid;2-(trimethylazaniumyl)acetate
CID 3084405
2-(3-hydroxyspiro[3.4]octan-3-yl)butanoic acid
CID 164658846

Frequently Asked Questions

What is the IUPAC name of 2-(3-ethyl-1-hydroxycyclopentyl)butanoic acid?
The IUPAC name of 2-(3-ethyl-1-hydroxycyclopentyl)butanoic acid (CID 64515512) is 2-(3-ethyl-1-hydroxycyclopentyl)butanoic acid.
What is the SMILES notation for 2-(3-ethyl-1-hydroxycyclopentyl)butanoic acid?
The canonical SMILES for 2-(3-ethyl-1-hydroxycyclopentyl)butanoic acid is CCC1CCC(O)(C(CC)C(=O)O)C1.
What is the InChIKey of 2-(3-ethyl-1-hydroxycyclopentyl)butanoic acid?
The InChIKey is UAGRYSNNQWUHBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-3-8-5-6-11(14,7-8)9(4-2)10(12)13/h8-9,14H,3-7H2,1-2H3,(H,12,13).
What are the key properties of 2-(3-ethyl-1-hydroxycyclopentyl)butanoic acid?
2-(3-ethyl-1-hydroxycyclopentyl)butanoic acid has a molecular weight of 200.28 g/mol, XLogP of 2.04, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethyl-1-hydroxycyclopentyl)butanoic acid is sourced from PubChem (CID 64515512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).