1,1,2,2,2-pentafluoroethanesulfonyl fluoride

C2F6O2S — CID 6451567

IUPAC1,1,2,2,2-pentafluoroethanesulfonyl fluoride
SMILESO=S(=O)(F)C(F)(F)C(F)(F)F
InChIInChI=1S/C2F6O2S/c3-1(4,5)2(6,7)11(8,9)10
InChIKeyJUZCVRZJGRPWJZ-UHFFFAOYSA-N
MW202.07 g/mol
LogP1.44
Rot. Bonds1

About 1,1,2,2,2-pentafluoroethanesulfonyl fluoride

1,1,2,2,2-pentafluoroethanesulfonyl fluoride (PubChem CID 6451567) has the molecular formula C2F6O2S and a molecular weight of 202.07 g/mol. Its IUPAC name is 1,1,2,2,2-pentafluoroethanesulfonyl fluoride.

Molecular Properties

Compound Name1,1,2,2,2-pentafluoroethanesulfonyl fluoride
PubChem CID6451567
Molecular FormulaC2F6O2S
Molecular Weight202.07 g/mol
Exact Mass201.95
IUPAC Name1,1,2,2,2-pentafluoroethanesulfonyl fluoride
SMILESO=S(=O)(F)C(F)(F)C(F)(F)F
InChIInChI=1S/C2F6O2S/c3-1(4,5)2(6,7)11(8,9)10
InChIKeyJUZCVRZJGRPWJZ-UHFFFAOYSA-N
XLogP1.44
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.07
LogP ≤ 51.44
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze 1,1,2,2,2-pentafluoroethanesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,1,2,2,2-pentafluoroethanesulfonyl fluoride?
The IUPAC name of 1,1,2,2,2-pentafluoroethanesulfonyl fluoride (CID 6451567) is 1,1,2,2,2-pentafluoroethanesulfonyl fluoride.
What is the SMILES notation for 1,1,2,2,2-pentafluoroethanesulfonyl fluoride?
The canonical SMILES for 1,1,2,2,2-pentafluoroethanesulfonyl fluoride is O=S(=O)(F)C(F)(F)C(F)(F)F.
What is the InChIKey of 1,1,2,2,2-pentafluoroethanesulfonyl fluoride?
The InChIKey is JUZCVRZJGRPWJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2F6O2S/c3-1(4,5)2(6,7)11(8,9)10.
What are the key properties of 1,1,2,2,2-pentafluoroethanesulfonyl fluoride?
1,1,2,2,2-pentafluoroethanesulfonyl fluoride has a molecular weight of 202.07 g/mol, XLogP of 1.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2,2,2-pentafluoroethanesulfonyl fluoride is sourced from PubChem (CID 6451567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).