About 1-chloro-3-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentane
1-chloro-3-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentane (PubChem CID 64515673) has the molecular formula C10H16ClF3O
and a molecular weight of 244.68 g/mol. Its IUPAC name is 1-chloro-3-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentane.
Molecular Properties
| Compound Name | 1-chloro-3-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentane |
| PubChem CID | 64515673 |
| Molecular Formula | C10H16ClF3O |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-chloro-3-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentane |
| SMILES | FC(F)(F)COCCCC1CCC(Cl)C1 |
| InChI | InChI=1S/C10H16ClF3O/c11-9-4-3-8(6-9)2-1-5-15-7-10(12,13)14/h8-9H,1-7H2 |
| InChIKey | ZCPFHKVKSVSXRS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentane?
The IUPAC name of 1-chloro-3-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentane (CID 64515673) is 1-chloro-3-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentane.
What is the SMILES notation for 1-chloro-3-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentane?
The canonical SMILES for 1-chloro-3-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentane is FC(F)(F)COCCCC1CCC(Cl)C1.
What is the InChIKey of 1-chloro-3-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentane?
The InChIKey is ZCPFHKVKSVSXRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16ClF3O/c11-9-4-3-8(6-9)2-1-5-15-7-10(12,13)14/h8-9H,1-7H2.
What are the key properties of 1-chloro-3-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentane?
1-chloro-3-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentane has a molecular weight of 244.68 g/mol, XLogP of 3.75, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-[3-(2,2,2-trifluoroethoxy)propyl]cyclopentane is sourced from PubChem (CID 64515673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).