About [3-methyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol
[3-methyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol (PubChem CID 64515982) has the molecular formula C9H16F3NO
and a molecular weight of 211.23 g/mol. Its IUPAC name is [3-methyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol.
Molecular Properties
| Compound Name | [3-methyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol |
| PubChem CID | 64515982 |
| Molecular Formula | C9H16F3NO |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | [3-methyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol |
| SMILES | CC1CCC(CO)(NCC(F)(F)F)C1 |
| InChI | InChI=1S/C9H16F3NO/c1-7-2-3-8(4-7,6-14)13-5-9(10,11)12/h7,13-14H,2-6H2,1H3 |
| InChIKey | AOHKFAMFCIOOLB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-methyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol?
The IUPAC name of [3-methyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol (CID 64515982) is [3-methyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol.
What is the SMILES notation for [3-methyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol?
The canonical SMILES for [3-methyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol is CC1CCC(CO)(NCC(F)(F)F)C1.
What is the InChIKey of [3-methyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol?
The InChIKey is AOHKFAMFCIOOLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO/c1-7-2-3-8(4-7,6-14)13-5-9(10,11)12/h7,13-14H,2-6H2,1H3.
What are the key properties of [3-methyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol?
[3-methyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol has a molecular weight of 211.23 g/mol, XLogP of 1.69, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol is sourced from PubChem (CID 64515982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).