C11H21NO2 — CID 64516179
3-methyl-1-(2-methylpropylamino)cyclopentane-1-carboxylic acid (PubChem CID 64516179) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 3-methyl-1-(2-methylpropylamino)cyclopentane-1-carboxylic acid.
| Compound Name | 3-methyl-1-(2-methylpropylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 64516179 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 3-methyl-1-(2-methylpropylamino)cyclopentane-1-carboxylic acid |
| SMILES | CC(C)CNC1(C(=O)O)CCC(C)C1 |
| InChI | InChI=1S/C11H21NO2/c1-8(2)7-12-11(10(13)14)5-4-9(3)6-11/h8-9,12H,4-7H2,1-3H3,(H,13,14) |
| InChIKey | TWBPQVOQJRTQSE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |