About 4-methylbenzenesulfonate;tetramethylazanium
4-methylbenzenesulfonate;tetramethylazanium (PubChem CID 6451622) has the molecular formula C11H19NO3S
and a molecular weight of 245.34 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;tetramethylazanium.
Molecular Properties
| Compound Name | 4-methylbenzenesulfonate;tetramethylazanium |
| PubChem CID | 6451622 |
| Molecular Formula | C11H19NO3S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 4-methylbenzenesulfonate;tetramethylazanium |
| SMILES | C[N+](C)(C)C.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C7H8O3S.C4H12N/c1-6-2-4-7(5-3-6)11(8,9)10;1-5(2,3)4/h2-5H,1H3,(H,8,9,10);1-4H3/q;+1/p-1 |
| InChIKey | FHVCZJGBXWNGIZ-UHFFFAOYSA-M |
| XLogP | 1.22 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenesulfonate;tetramethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenesulfonate;tetramethylazanium?
The IUPAC name of 4-methylbenzenesulfonate;tetramethylazanium (CID 6451622) is 4-methylbenzenesulfonate;tetramethylazanium.
What is the SMILES notation for 4-methylbenzenesulfonate;tetramethylazanium?
The canonical SMILES for 4-methylbenzenesulfonate;tetramethylazanium is C[N+](C)(C)C.Cc1ccc(S(=O)(=O)[O-])cc1.
What is the InChIKey of 4-methylbenzenesulfonate;tetramethylazanium?
The InChIKey is FHVCZJGBXWNGIZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8O3S.C4H12N/c1-6-2-4-7(5-3-6)11(8,9)10;1-5(2,3)4/h2-5H,1H3,(H,8,9,10);1-4H3/q;+1/p-1.
What are the key properties of 4-methylbenzenesulfonate;tetramethylazanium?
4-methylbenzenesulfonate;tetramethylazanium has a molecular weight of 245.34 g/mol, XLogP of 1.22, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenesulfonate;tetramethylazanium is sourced from PubChem (CID 6451622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).