About 2,2-bis(oxiran-2-ylmethoxymethyl)propane-1,3-diol
2,2-bis(oxiran-2-ylmethoxymethyl)propane-1,3-diol (PubChem CID 6451645) has the molecular formula C11H20O6
and a molecular weight of 248.27 g/mol. Its IUPAC name is 2,2-bis(oxiran-2-ylmethoxymethyl)propane-1,3-diol.
Molecular Properties
| Compound Name | 2,2-bis(oxiran-2-ylmethoxymethyl)propane-1,3-diol |
| PubChem CID | 6451645 |
| Molecular Formula | C11H20O6 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2,2-bis(oxiran-2-ylmethoxymethyl)propane-1,3-diol |
| SMILES | OCC(CO)(COCC1CO1)COCC1CO1 |
| InChI | InChI=1S/C11H20O6/c12-5-11(6-13,7-14-1-9-3-16-9)8-15-2-10-4-17-10/h9-10,12-13H,1-8H2 |
| InChIKey | FGPFIXISGWXSCE-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(oxiran-2-ylmethoxymethyl)propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(oxiran-2-ylmethoxymethyl)propane-1,3-diol?
The IUPAC name of 2,2-bis(oxiran-2-ylmethoxymethyl)propane-1,3-diol (CID 6451645) is 2,2-bis(oxiran-2-ylmethoxymethyl)propane-1,3-diol.
What is the SMILES notation for 2,2-bis(oxiran-2-ylmethoxymethyl)propane-1,3-diol?
The canonical SMILES for 2,2-bis(oxiran-2-ylmethoxymethyl)propane-1,3-diol is OCC(CO)(COCC1CO1)COCC1CO1.
What is the InChIKey of 2,2-bis(oxiran-2-ylmethoxymethyl)propane-1,3-diol?
The InChIKey is FGPFIXISGWXSCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O6/c12-5-11(6-13,7-14-1-9-3-16-9)8-15-2-10-4-17-10/h9-10,12-13H,1-8H2.
What are the key properties of 2,2-bis(oxiran-2-ylmethoxymethyl)propane-1,3-diol?
2,2-bis(oxiran-2-ylmethoxymethyl)propane-1,3-diol has a molecular weight of 248.27 g/mol, XLogP of -1.21, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(oxiran-2-ylmethoxymethyl)propane-1,3-diol is sourced from PubChem (CID 6451645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).