About dimethyl(oxo)silane;methyl-oxo-phenylsilane
dimethyl(oxo)silane;methyl-oxo-phenylsilane (PubChem CID 6451673) has the molecular formula C9H14O2Si2
and a molecular weight of 210.38 g/mol. Its IUPAC name is dimethyl(oxo)silane;methyl-oxo-phenylsilane.
Molecular Properties
| Compound Name | dimethyl(oxo)silane;methyl-oxo-phenylsilane |
| PubChem CID | 6451673 |
| Molecular Formula | C9H14O2Si2 |
| Molecular Weight | 210.38 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | dimethyl(oxo)silane;methyl-oxo-phenylsilane |
| SMILES | C[Si](=O)c1ccccc1.C[Si](C)=O |
| InChI | InChI=1S/C7H8OSi.C2H6OSi/c1-9(8)7-5-3-2-4-6-7;1-4(2)3/h2-6H,1H3;1-2H3 |
| InChIKey | XWFOTLCDICUQTI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(oxo)silane;methyl-oxo-phenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(oxo)silane;methyl-oxo-phenylsilane?
The IUPAC name of dimethyl(oxo)silane;methyl-oxo-phenylsilane (CID 6451673) is dimethyl(oxo)silane;methyl-oxo-phenylsilane.
What is the SMILES notation for dimethyl(oxo)silane;methyl-oxo-phenylsilane?
The canonical SMILES for dimethyl(oxo)silane;methyl-oxo-phenylsilane is C[Si](=O)c1ccccc1.C[Si](C)=O.
What is the InChIKey of dimethyl(oxo)silane;methyl-oxo-phenylsilane?
The InChIKey is XWFOTLCDICUQTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8OSi.C2H6OSi/c1-9(8)7-5-3-2-4-6-7;1-4(2)3/h2-6H,1H3;1-2H3.
What are the key properties of dimethyl(oxo)silane;methyl-oxo-phenylsilane?
dimethyl(oxo)silane;methyl-oxo-phenylsilane has a molecular weight of 210.38 g/mol, XLogP of 1.61, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(oxo)silane;methyl-oxo-phenylsilane is sourced from PubChem (CID 6451673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).