About 1,4-bis(2-ethyl-6-methylanilino)anthracene-9,10-dione
1,4-bis(2-ethyl-6-methylanilino)anthracene-9,10-dione (PubChem CID 6451771) has the molecular formula C32H30N2O2
and a molecular weight of 474.60 g/mol. Its IUPAC name is 1,4-bis(2-ethyl-6-methylanilino)anthracene-9,10-dione.
Molecular Properties
| Compound Name | 1,4-bis(2-ethyl-6-methylanilino)anthracene-9,10-dione |
| PubChem CID | 6451771 |
| Molecular Formula | C32H30N2O2 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 1,4-bis(2-ethyl-6-methylanilino)anthracene-9,10-dione |
| SMILES | CCc1cccc(C)c1Nc1ccc(Nc2c(C)cccc2CC)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C32H30N2O2/c1-5-21-13-9-11-19(3)29(21)33-25-17-18-26(34-30-20(4)12-10-14-22(30)6-2)28-27(25)31(35)23-15-7-8-16-24(23)32(28)36/h7-18,33-34H,5-6H2,1-4H3 |
| InChIKey | NPJJGMRERPXCSE-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis(2-ethyl-6-methylanilino)anthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(2-ethyl-6-methylanilino)anthracene-9,10-dione?
The IUPAC name of 1,4-bis(2-ethyl-6-methylanilino)anthracene-9,10-dione (CID 6451771) is 1,4-bis(2-ethyl-6-methylanilino)anthracene-9,10-dione.
What is the SMILES notation for 1,4-bis(2-ethyl-6-methylanilino)anthracene-9,10-dione?
The canonical SMILES for 1,4-bis(2-ethyl-6-methylanilino)anthracene-9,10-dione is CCc1cccc(C)c1Nc1ccc(Nc2c(C)cccc2CC)c2c1C(=O)c1ccccc1C2=O.
What is the InChIKey of 1,4-bis(2-ethyl-6-methylanilino)anthracene-9,10-dione?
The InChIKey is NPJJGMRERPXCSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H30N2O2/c1-5-21-13-9-11-19(3)29(21)33-25-17-18-26(34-30-20(4)12-10-14-22(30)6-2)28-27(25)31(35)23-15-7-8-16-24(23)32(28)36/h7-18,33-34H,5-6H2,1-4H3.
What are the key properties of 1,4-bis(2-ethyl-6-methylanilino)anthracene-9,10-dione?
1,4-bis(2-ethyl-6-methylanilino)anthracene-9,10-dione has a molecular weight of 474.60 g/mol, XLogP of 7.69, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(2-ethyl-6-methylanilino)anthracene-9,10-dione is sourced from PubChem (CID 6451771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).