C14H21Cl2N3O7 — CID 6451773
5-[bis(2-chloroethyl)amino]-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pyrimidine-2,4-dione (PubChem CID 6451773) has the molecular formula C14H21Cl2N3O7 and a molecular weight of 414.24 g/mol. Its IUPAC name is 5-[bis(2-chloroethyl)amino]-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-[bis(2-chloroethyl)amino]-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 6451773 |
| Molecular Formula | C14H21Cl2N3O7 |
| Molecular Weight | 414.24 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 5-[bis(2-chloroethyl)amino]-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1N(CCCl)CCCl |
| InChI | InChI=1S/C14H21Cl2N3O7/c15-1-3-18(4-2-16)7-5-19(14(25)17-12(7)24)13-11(23)10(22)9(21)8(6-20)26-13/h5,8-11,13,20-23H,1-4,6H2,(H,17,24,25)/t8-,9-,10+,11-,13-/m1/s1 |
| InChIKey | MLKSOOLHODPMQD-BZNQNGANSA-N |
| XLogP | -2.21 |
| TPSA | 148.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.24 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|