C11H12FN5O2S2 — CID 64517889
2-fluoro-6-[methyl(1H-1,2,4-triazol-5-ylmethyl)sulfamoyl]benzenecarbothioamide (PubChem CID 64517889) has the molecular formula C11H12FN5O2S2 and a molecular weight of 329.38 g/mol. Its IUPAC name is 2-fluoro-6-[methyl(1H-1,2,4-triazol-5-ylmethyl)sulfamoyl]benzenecarbothioamide.
| Compound Name | 2-fluoro-6-[methyl(1H-1,2,4-triazol-5-ylmethyl)sulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 64517889 |
| Molecular Formula | C11H12FN5O2S2 |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 2-fluoro-6-[methyl(1H-1,2,4-triazol-5-ylmethyl)sulfamoyl]benzenecarbothioamide |
| SMILES | CN(Cc1ncn[nH]1)S(=O)(=O)c1cccc(F)c1C(N)=S |
| InChI | InChI=1S/C11H12FN5O2S2/c1-17(5-9-14-6-15-16-9)21(18,19)8-4-2-3-7(12)10(8)11(13)20/h2-4,6H,5H2,1H3,(H2,13,20)(H,14,15,16) |
| InChIKey | HTXYONVAPXWXCX-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|