C15H27N5 — CID 64518188
1-(3-methylbut-2-enyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]piperidin-4-amine (PubChem CID 64518188) has the molecular formula C15H27N5 and a molecular weight of 277.42 g/mol. Its IUPAC name is 1-(3-methylbut-2-enyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]piperidin-4-amine.
| Compound Name | 1-(3-methylbut-2-enyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]piperidin-4-amine |
|---|---|
| PubChem CID | 64518188 |
| Molecular Formula | C15H27N5 |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.23 |
| IUPAC Name | 1-(3-methylbut-2-enyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]piperidin-4-amine |
| SMILES | CC(C)=CCN1CCC(NCCCc2ncn[nH]2)CC1 |
| InChI | InChI=1S/C15H27N5/c1-13(2)5-9-20-10-6-14(7-11-20)16-8-3-4-15-17-12-18-19-15/h5,12,14,16H,3-4,6-11H2,1-2H3,(H,17,18,19) |
| InChIKey | ZRTWUUDHMHEKIU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|