About N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-sulfonamide
N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-sulfonamide (PubChem CID 64518227) has the molecular formula C9H16N4O3S
and a molecular weight of 260.32 g/mol. Its IUPAC name is N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-sulfonamide.
Molecular Properties
| Compound Name | N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-sulfonamide |
| PubChem CID | 64518227 |
| Molecular Formula | C9H16N4O3S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-sulfonamide |
| SMILES | CN(Cc1ncn[nH]1)S(=O)(=O)C1CCOCC1 |
| InChI | InChI=1S/C9H16N4O3S/c1-13(6-9-10-7-11-12-9)17(14,15)8-2-4-16-5-3-8/h7-8H,2-6H2,1H3,(H,10,11,12) |
| InChIKey | FLFTVWYXBUZGHN-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-sulfonamide?
The IUPAC name of N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-sulfonamide (CID 64518227) is N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-sulfonamide.
What is the SMILES notation for N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-sulfonamide?
The canonical SMILES for N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-sulfonamide is CN(Cc1ncn[nH]1)S(=O)(=O)C1CCOCC1.
What is the InChIKey of N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-sulfonamide?
The InChIKey is FLFTVWYXBUZGHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O3S/c1-13(6-9-10-7-11-12-9)17(14,15)8-2-4-16-5-3-8/h7-8H,2-6H2,1H3,(H,10,11,12).
What are the key properties of N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-sulfonamide?
N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-sulfonamide has a molecular weight of 260.32 g/mol, XLogP of -0.25, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)oxane-4-sulfonamide is sourced from PubChem (CID 64518227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).